Abstract：Polymerization of 1-decene catalyzed by Ph2C(Cp-9-Flu)ZrCl2/C6H5NH(CH3)2B(C6H5)4/Al(iBu)3 catalyst system was studied. Effects of catalyst concentration, molar ratio of Al to Zr, molar ratio of origanic boranes(B) to Zr, reaction temperature and reaction time on polymer properties were investigated, and the polymers from 1-decene catalyzed by the Ph2C(Cp-9-Flu)ZrCl2/MAO catalyst system and Ph2C(Cp-9-Flu)ZrCl2/ C6H5NH(CH3)2B(C6H5)4/Al(iBu)3 catalyst system were characterized by means of nuclear magnetic resonance(NMR). The results showed that under the conditions of molar ratio of Zr to 1-decene 10×10-5, molar ratio of Al to Zr 100, reaction temperature 60℃ and reaction time 120 min, the conversion of 1-decene reached 93.6% and the kinematic viscosity (100℃) was 3 684 mm2/s, the viscosity index was 367, the number-average molecular weight (Mn) was 2.9×104, and the molecular weight distribution was 1.85. The polymerization reaction was mainly 1,2-insertion which produced vinylene end group.
